C9H13NO4 — CID 79345496
2-hydroxyethyl N-[1-(furan-2-yl)ethyl]carbamate (PubChem CID 79345496) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-hydroxyethyl N-[1-(furan-2-yl)ethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[1-(furan-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 79345496 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-hydroxyethyl N-[1-(furan-2-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OCCO)c1ccco1 |
| InChI | InChI=1S/C9H13NO4/c1-7(8-3-2-5-13-8)10-9(12)14-6-4-11/h2-3,5,7,11H,4,6H2,1H3,(H,10,12) |
| InChIKey | MRZSZCGFWDBRPX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |