C13H14N2OS — CID 79375047
2-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)ethanamine (PubChem CID 79375047) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)ethanamine.
| Compound Name | 2-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 79375047 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-(7-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)ethanamine |
| SMILES | COc1ccc2c(c1)-c1nc(CCN)sc1C2 |
| InChI | InChI=1S/C13H14N2OS/c1-16-9-3-2-8-6-11-13(10(8)7-9)15-12(17-11)4-5-14/h2-3,7H,4-6,14H2,1H3 |
| InChIKey | FWSHVDLOZGVABN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |