C10H14N4OS2 — CID 79391024
3-methyl-4-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-1,2-thiazol-5-amine (PubChem CID 79391024) has the molecular formula C10H14N4OS2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-methyl-4-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-1,2-thiazol-5-amine.
| Compound Name | 3-methyl-4-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 79391024 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-methyl-4-[3-(propylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]-1,2-thiazol-5-amine |
| SMILES | CCCSCc1noc(-c2c(C)nsc2N)n1 |
| InChI | InChI=1S/C10H14N4OS2/c1-3-4-16-5-7-12-10(15-13-7)8-6(2)14-17-9(8)11/h3-5,11H2,1-2H3 |
| InChIKey | ZJFDFDYHONVZED-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|