C12H8Cl2N2O2S — CID 793916
N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide (PubChem CID 793916) has the molecular formula C12H8Cl2N2O2S and a molecular weight of 315.18 g/mol. Its IUPAC name is N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 793916 |
| Molecular Formula | C12H8Cl2N2O2S |
| Molecular Weight | 315.18 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | N'-(3,4-dichlorobenzoyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2O2S/c13-8-4-3-7(6-9(8)14)11(17)15-16-12(18)10-2-1-5-19-10/h1-6H,(H,15,17)(H,16,18) |
| InChIKey | CRMABLWTACFMPY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|