C14H18Cl2N2O — CID 79394410
N-cyclopropyl-3-[1-(2,5-dichlorophenyl)ethylamino]propanamide (PubChem CID 79394410) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-cyclopropyl-3-[1-(2,5-dichlorophenyl)ethylamino]propanamide.
| Compound Name | N-cyclopropyl-3-[1-(2,5-dichlorophenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 79394410 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-cyclopropyl-3-[1-(2,5-dichlorophenyl)ethylamino]propanamide |
| SMILES | CC(NCCC(=O)NC1CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9(12-8-10(15)2-5-13(12)16)17-7-6-14(19)18-11-3-4-11/h2,5,8-9,11,17H,3-4,6-7H2,1H3,(H,18,19) |
| InChIKey | CVUBPOLNWPYSCG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |