C15H20Br2N2O — CID 79394511
N-cyclopropyl-4-[1-(2,4-dibromophenyl)ethylamino]butanamide (PubChem CID 79394511) has the molecular formula C15H20Br2N2O and a molecular weight of 404.15 g/mol. Its IUPAC name is N-cyclopropyl-4-[1-(2,4-dibromophenyl)ethylamino]butanamide.
| Compound Name | N-cyclopropyl-4-[1-(2,4-dibromophenyl)ethylamino]butanamide |
|---|---|
| PubChem CID | 79394511 |
| Molecular Formula | C15H20Br2N2O |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | N-cyclopropyl-4-[1-(2,4-dibromophenyl)ethylamino]butanamide |
| SMILES | CC(NCCCC(=O)NC1CC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H20Br2N2O/c1-10(13-7-4-11(16)9-14(13)17)18-8-2-3-15(20)19-12-5-6-12/h4,7,9-10,12,18H,2-3,5-6,8H2,1H3,(H,19,20) |
| InChIKey | LDZGIBFVQGDSDH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|