C9H15BrN2S — CID 79398898
4-bromo-N-methyl-N-pentyl-1,3-thiazol-2-amine (PubChem CID 79398898) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-pentyl-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-methyl-N-pentyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79398898 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 4-bromo-N-methyl-N-pentyl-1,3-thiazol-2-amine |
| SMILES | CCCCCN(C)c1nc(Br)cs1 |
| InChI | InChI=1S/C9H15BrN2S/c1-3-4-5-6-12(2)9-11-8(10)7-13-9/h7H,3-6H2,1-2H3 |
| InChIKey | OCUUOKOCRPXIKS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|