C7H10BrN3S2 — CID 79399462
3-[(4-bromo-1,3-thiazol-2-yl)-methylamino]propanethioamide (PubChem CID 79399462) has the molecular formula C7H10BrN3S2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 3-[(4-bromo-1,3-thiazol-2-yl)-methylamino]propanethioamide.
| Compound Name | 3-[(4-bromo-1,3-thiazol-2-yl)-methylamino]propanethioamide |
|---|---|
| PubChem CID | 79399462 |
| Molecular Formula | C7H10BrN3S2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 3-[(4-bromo-1,3-thiazol-2-yl)-methylamino]propanethioamide |
| SMILES | CN(CCC(N)=S)c1nc(Br)cs1 |
| InChI | InChI=1S/C7H10BrN3S2/c1-11(3-2-6(9)12)7-10-5(8)4-13-7/h4H,2-3H2,1H3,(H2,9,12) |
| InChIKey | VWDYQRXSVVAKJP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|