C8H13BrN2OS — CID 104696832
4-[(4-bromo-1,3-thiazol-2-yl)-methylamino]butan-2-ol (PubChem CID 104696832) has the molecular formula C8H13BrN2OS and a molecular weight of 265.18 g/mol. Its IUPAC name is 4-[(4-bromo-1,3-thiazol-2-yl)-methylamino]butan-2-ol.
| Compound Name | 4-[(4-bromo-1,3-thiazol-2-yl)-methylamino]butan-2-ol |
|---|---|
| PubChem CID | 104696832 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 4-[(4-bromo-1,3-thiazol-2-yl)-methylamino]butan-2-ol |
| SMILES | CC(O)CCN(C)c1nc(Br)cs1 |
| InChI | InChI=1S/C8H13BrN2OS/c1-6(12)3-4-11(2)8-10-7(9)5-13-8/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | DAPRCCGJRQMPTL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |