C16H16N4O2S — CID 7940375
2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethyl benzoate (PubChem CID 7940375) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethyl benzoate.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethyl benzoate |
|---|---|
| PubChem CID | 7940375 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethyl benzoate |
| SMILES | Cc1cc(C)n2c(SCCOC(=O)c3ccccc3)nnc2n1 |
| InChI | InChI=1S/C16H16N4O2S/c1-11-10-12(2)20-15(17-11)18-19-16(20)23-9-8-22-14(21)13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | OZIBEZXCDWLXJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|