C16H26ClNO2S — CID 79436256
2-(2-chlorophenyl)-N-(2-methylpropyl)-5-methylsulfonylpentan-1-amine (PubChem CID 79436256) has the molecular formula C16H26ClNO2S and a molecular weight of 331.91 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2-methylpropyl)-5-methylsulfonylpentan-1-amine.
| Compound Name | 2-(2-chlorophenyl)-N-(2-methylpropyl)-5-methylsulfonylpentan-1-amine |
|---|---|
| PubChem CID | 79436256 |
| Molecular Formula | C16H26ClNO2S |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2-methylpropyl)-5-methylsulfonylpentan-1-amine |
| SMILES | CC(C)CNCC(CCCS(C)(=O)=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H26ClNO2S/c1-13(2)11-18-12-14(7-6-10-21(3,19)20)15-8-4-5-9-16(15)17/h4-5,8-9,13-14,18H,6-7,10-12H2,1-3H3 |
| InChIKey | CZVIHWYYKUJVFS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |