C14H17BrN2S — CID 79443219
2-(3-bromophenyl)-4-(4-methyl-1,3-thiazol-5-yl)butan-1-amine (PubChem CID 79443219) has the molecular formula C14H17BrN2S and a molecular weight of 325.28 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-(4-methyl-1,3-thiazol-5-yl)butan-1-amine.
| Compound Name | 2-(3-bromophenyl)-4-(4-methyl-1,3-thiazol-5-yl)butan-1-amine |
|---|---|
| PubChem CID | 79443219 |
| Molecular Formula | C14H17BrN2S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 2-(3-bromophenyl)-4-(4-methyl-1,3-thiazol-5-yl)butan-1-amine |
| SMILES | Cc1ncsc1CCC(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrN2S/c1-10-14(18-9-17-10)6-5-12(8-16)11-3-2-4-13(15)7-11/h2-4,7,9,12H,5-6,8,16H2,1H3 |
| InChIKey | BIFATALRTPNGOX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |