C22H24ClNOS — CID 7945317
N-(1-adamantyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide (PubChem CID 7945317) has the molecular formula C22H24ClNOS and a molecular weight of 385.96 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide.
| Compound Name | N-(1-adamantyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7945317 |
| Molecular Formula | C22H24ClNOS |
| Molecular Weight | 385.96 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | N-(1-adamantyl)-2-(8-chloronaphthalen-1-yl)sulfanylacetamide |
| SMILES | O=C(CSc1cccc2cccc(Cl)c12)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H24ClNOS/c23-18-5-1-3-17-4-2-6-19(21(17)18)26-13-20(25)24-22-10-14-7-15(11-22)9-16(8-14)12-22/h1-6,14-16H,7-13H2,(H,24,25) |
| InChIKey | TVZCJLDSOKYBIZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |