About N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine
N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine (PubChem CID 79492342) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine |
| PubChem CID | 79492342 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine |
| SMILES | CCNC(CC(C)CC)C(OC)OC |
| InChI | InChI=1S/C11H25NO2/c1-6-9(3)8-10(12-7-2)11(13-4)14-5/h9-12H,6-8H2,1-5H3 |
| InChIKey | YMHBNDXAALZPBX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine?
The IUPAC name of N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine (CID 79492342) is N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine.
What is the SMILES notation for N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine?
The canonical SMILES for N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine is CCNC(CC(C)CC)C(OC)OC.
What is the InChIKey of N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine?
The InChIKey is YMHBNDXAALZPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO2/c1-6-9(3)8-10(12-7-2)11(13-4)14-5/h9-12H,6-8H2,1-5H3.
What are the key properties of N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine?
N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine has a molecular weight of 203.33 g/mol, XLogP of 2.02, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-dimethoxy-4-methylhexan-2-amine is sourced from PubChem (CID 79492342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).