C13H22N2O2 — CID 79493387
1,1-dimethoxy-N-propyl-3-pyridin-4-ylpropan-2-amine (PubChem CID 79493387) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,1-dimethoxy-N-propyl-3-pyridin-4-ylpropan-2-amine.
| Compound Name | 1,1-dimethoxy-N-propyl-3-pyridin-4-ylpropan-2-amine |
|---|---|
| PubChem CID | 79493387 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1,1-dimethoxy-N-propyl-3-pyridin-4-ylpropan-2-amine |
| SMILES | CCCNC(Cc1ccncc1)C(OC)OC |
| InChI | InChI=1S/C13H22N2O2/c1-4-7-15-12(13(16-2)17-3)10-11-5-8-14-9-6-11/h5-6,8-9,12-13,15H,4,7,10H2,1-3H3 |
| InChIKey | YBQVEDPDTJGJSU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|