C15H22N2O2S — CID 79819111
3-(1,3-benzothiazol-2-yl)-1,1-dimethoxy-N-propylpropan-2-amine (PubChem CID 79819111) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-1,1-dimethoxy-N-propylpropan-2-amine.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-1,1-dimethoxy-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 79819111 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-1,1-dimethoxy-N-propylpropan-2-amine |
| SMILES | CCCNC(Cc1nc2ccccc2s1)C(OC)OC |
| InChI | InChI=1S/C15H22N2O2S/c1-4-9-16-12(15(18-2)19-3)10-14-17-11-7-5-6-8-13(11)20-14/h5-8,12,15-16H,4,9-10H2,1-3H3 |
| InChIKey | VYYONMPEHLUKQB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|