C10H19N3 — CID 79497308
5-(2-methylpropyl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine (PubChem CID 79497308) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-(2-methylpropyl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79497308 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 5-(2-methylpropyl)-1-prop-2-enyl-4,5-dihydroimidazol-2-amine |
| SMILES | C=CCN1C(N)=NCC1CC(C)C |
| InChI | InChI=1S/C10H19N3/c1-4-5-13-9(6-8(2)3)7-12-10(13)11/h4,8-9H,1,5-7H2,2-3H3,(H2,11,12) |
| InChIKey | HYOANAIWCCJUMV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|