C7H11N3O2 — CID 79502466
5-methyl-2-(methylaminomethyl)-1H-pyrimidine-4,6-dione (PubChem CID 79502466) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 5-methyl-2-(methylaminomethyl)-1H-pyrimidine-4,6-dione.
| Compound Name | 5-methyl-2-(methylaminomethyl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79502466 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5-methyl-2-(methylaminomethyl)-1H-pyrimidine-4,6-dione |
| SMILES | CNCC1=NC(=O)C(C)C(=O)N1 |
| InChI | InChI=1S/C7H11N3O2/c1-4-6(11)9-5(3-8-2)10-7(4)12/h4,8H,3H2,1-2H3,(H,9,10,11,12) |
| InChIKey | ZGWSQSRHZVJSDQ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|