C10H16N4O2 — CID 79500956
2-(1,4-diazepan-1-yl)-5-methyl-1H-pyrimidine-4,6-dione (PubChem CID 79500956) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-5-methyl-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1,4-diazepan-1-yl)-5-methyl-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79500956 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-5-methyl-1H-pyrimidine-4,6-dione |
| SMILES | CC1C(=O)N=C(N2CCCNCC2)NC1=O |
| InChI | InChI=1S/C10H16N4O2/c1-7-8(15)12-10(13-9(7)16)14-5-2-3-11-4-6-14/h7,11H,2-6H2,1H3,(H,12,13,15,16) |
| InChIKey | LJYIFQRTMRBDGU-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|