C11H18N4O2 — CID 79500955
2-(1,4-diazepan-1-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione (PubChem CID 79500955) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1,4-diazepan-1-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79500955 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione |
| SMILES | CC1(C)C(=O)N=C(N2CCCNCC2)NC1=O |
| InChI | InChI=1S/C11H18N4O2/c1-11(2)8(16)13-10(14-9(11)17)15-6-3-4-12-5-7-15/h12H,3-7H2,1-2H3,(H,13,14,16,17) |
| InChIKey | JSYHKZBTYXRIOP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|