C13H22N4O2 — CID 79502051
5,5-dimethyl-2-(1-piperazin-1-ylpropyl)-1H-pyrimidine-4,6-dione (PubChem CID 79502051) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1-piperazin-1-ylpropyl)-1H-pyrimidine-4,6-dione.
| Compound Name | 5,5-dimethyl-2-(1-piperazin-1-ylpropyl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79502051 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 5,5-dimethyl-2-(1-piperazin-1-ylpropyl)-1H-pyrimidine-4,6-dione |
| SMILES | CCC(C1=NC(=O)C(C)(C)C(=O)N1)N1CCNCC1 |
| InChI | InChI=1S/C13H22N4O2/c1-4-9(17-7-5-14-6-8-17)10-15-11(18)13(2,3)12(19)16-10/h9,14H,4-8H2,1-3H3,(H,15,16,18,19) |
| InChIKey | MSNQTJZKJODXBH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|