C11H14N4OS — CID 162243328
2-piperazin-1-yl-4-(3H-thiophen-2-ylidene)-1H-imidazol-5-one (PubChem CID 162243328) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-(3H-thiophen-2-ylidene)-1H-imidazol-5-one.
| Compound Name | 2-piperazin-1-yl-4-(3H-thiophen-2-ylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 162243328 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-piperazin-1-yl-4-(3H-thiophen-2-ylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(N2CCNCC2)=NC1=C1CC=CS1 |
| InChI | InChI=1S/C11H14N4OS/c16-10-9(8-2-1-7-17-8)13-11(14-10)15-5-3-12-4-6-15/h1,7,12H,2-6H2,(H,13,14,16) |
| InChIKey | RHRYWVVILGIWGV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|