C7H11N3S — CID 96739347
5-piperazin-1-yl-1,3-thiazole (PubChem CID 96739347) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-piperazin-1-yl-1,3-thiazole.
| Compound Name | 5-piperazin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 96739347 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 5-piperazin-1-yl-1,3-thiazole |
| SMILES | c1ncc(N2CCNCC2)s1 |
| InChI | InChI=1S/C7H11N3S/c1-3-10(4-2-8-1)7-5-9-6-11-7/h5-6,8H,1-4H2 |
| InChIKey | VEXTWFPILXXIPZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |