C7H14N6 — CID 79510061
5-(azidomethyl)-1-propyl-4,5-dihydroimidazol-2-amine (PubChem CID 79510061) has the molecular formula C7H14N6 and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-(azidomethyl)-1-propyl-4,5-dihydroimidazol-2-amine.
| Compound Name | 5-(azidomethyl)-1-propyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79510061 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 5-(azidomethyl)-1-propyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCN1C(N)=NCC1CN=[N+]=[N-] |
| InChI | InChI=1S/C7H14N6/c1-2-3-13-6(5-11-12-9)4-10-7(13)8/h6H,2-5H2,1H3,(H2,8,10) |
| InChIKey | ZWQDNHUTLGNHQB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|