C9H13NO4S — CID 79516428
1-(3-methyl-1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione (PubChem CID 79516428) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione.
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 79516428 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)pyrrolidine-2,4-dione |
| SMILES | CC1(N2CC(=O)CC2=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13NO4S/c1-9(2-3-15(13,14)6-9)10-5-7(11)4-8(10)12/h2-6H2,1H3 |
| InChIKey | VHUBBOFTMMEZTP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|