C14H17FN2S — CID 79519850
2-(2-bicyclo[2.2.1]heptanylamino)-6-fluorobenzenecarbothioamide (PubChem CID 79519850) has the molecular formula C14H17FN2S and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylamino)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylamino)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 79519850 |
| Molecular Formula | C14H17FN2S |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylamino)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1NC1CC2CCC1C2 |
| InChI | InChI=1S/C14H17FN2S/c15-10-2-1-3-11(13(10)14(16)18)17-12-7-8-4-5-9(12)6-8/h1-3,8-9,12,17H,4-7H2,(H2,16,18) |
| InChIKey | FWJXAOJHNLJIDN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|