C11H11F3N4O2S — CID 79531474
N-[(5-amino-1H-pyrazol-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 79531474) has the molecular formula C11H11F3N4O2S and a molecular weight of 320.30 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79531474 |
| Molecular Formula | C11H11F3N4O2S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | Nc1[nH]ncc1CNS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N4O2S/c12-11(13,14)8-3-1-2-4-9(8)21(19,20)17-6-7-5-16-18-10(7)15/h1-5,17H,6H2,(H3,15,16,18) |
| InChIKey | QJDQKBIDZYCODV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |