C10H17F2N3O2S — CID 79552357
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 79552357) has the molecular formula C10H17F2N3O2S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 79552357 |
| Molecular Formula | C10H17F2N3O2S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CC(C)(CNCc1nccn1C(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C10H17F2N3O2S/c1-10(2,18(3,16)17)7-13-6-8-14-4-5-15(8)9(11)12/h4-5,9,13H,6-7H2,1-3H3 |
| InChIKey | IZJQQZGCTHBZLG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |