C8H11BrO2S — CID 79567182
1-(4-bromothiophen-2-yl)-2-ethoxyethanol (PubChem CID 79567182) has the molecular formula C8H11BrO2S and a molecular weight of 251.14 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-2-ethoxyethanol.
| Compound Name | 1-(4-bromothiophen-2-yl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 79567182 |
| Molecular Formula | C8H11BrO2S |
| Molecular Weight | 251.14 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-2-ethoxyethanol |
| SMILES | CCOCC(O)c1cc(Br)cs1 |
| InChI | InChI=1S/C8H11BrO2S/c1-2-11-4-7(10)8-3-6(9)5-12-8/h3,5,7,10H,2,4H2,1H3 |
| InChIKey | BBRLRJOHJYZWSP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |