C14H22ClNO3S — CID 79585929
3-chloro-N-ethyl-N-[1-(3-hydroxyphenyl)ethyl]-2-methylpropane-1-sulfonamide (PubChem CID 79585929) has the molecular formula C14H22ClNO3S and a molecular weight of 319.85 g/mol. Its IUPAC name is 3-chloro-N-ethyl-N-[1-(3-hydroxyphenyl)ethyl]-2-methylpropane-1-sulfonamide.
| Compound Name | 3-chloro-N-ethyl-N-[1-(3-hydroxyphenyl)ethyl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 79585929 |
| Molecular Formula | C14H22ClNO3S |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-chloro-N-ethyl-N-[1-(3-hydroxyphenyl)ethyl]-2-methylpropane-1-sulfonamide |
| SMILES | CCN(C(C)c1cccc(O)c1)S(=O)(=O)CC(C)CCl |
| InChI | InChI=1S/C14H22ClNO3S/c1-4-16(20(18,19)10-11(2)9-15)12(3)13-6-5-7-14(17)8-13/h5-8,11-12,17H,4,9-10H2,1-3H3 |
| InChIKey | HJNQRHRMRKMMSK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|