C10H20N2O2S — CID 79589412
N-[3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propyl]cyclopropanamine (PubChem CID 79589412) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-[3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 79589412 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-[3-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)propyl]cyclopropanamine |
| SMILES | CC1CN(CCCNC2CC2)S(=O)(=O)C1 |
| InChI | InChI=1S/C10H20N2O2S/c1-9-7-12(15(13,14)8-9)6-2-5-11-10-3-4-10/h9-11H,2-8H2,1H3 |
| InChIKey | OKJDSOZILWAUAS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|