C15H16BrNOS — CID 79602381
N-[[5-(4-bromothiophen-3-yl)-2-methoxyphenyl]methyl]cyclopropanamine (PubChem CID 79602381) has the molecular formula C15H16BrNOS and a molecular weight of 338.27 g/mol. Its IUPAC name is N-[[5-(4-bromothiophen-3-yl)-2-methoxyphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(4-bromothiophen-3-yl)-2-methoxyphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 79602381 |
| Molecular Formula | C15H16BrNOS |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | N-[[5-(4-bromothiophen-3-yl)-2-methoxyphenyl]methyl]cyclopropanamine |
| SMILES | COc1ccc(-c2cscc2Br)cc1CNC1CC1 |
| InChI | InChI=1S/C15H16BrNOS/c1-18-15-5-2-10(13-8-19-9-14(13)16)6-11(15)7-17-12-3-4-12/h2,5-6,8-9,12,17H,3-4,7H2,1H3 |
| InChIKey | KIZWGPRLMKPPSQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |