C8H17N3O4S — CID 79681146
N'-hydroxy-4-(2-methylsulfonylethyl)morpholine-2-carboximidamide (PubChem CID 79681146) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is N'-hydroxy-4-(2-methylsulfonylethyl)morpholine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-(2-methylsulfonylethyl)morpholine-2-carboximidamide |
|---|---|
| PubChem CID | 79681146 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N'-hydroxy-4-(2-methylsulfonylethyl)morpholine-2-carboximidamide |
| SMILES | CS(=O)(=O)CCN1CCOC(C(N)=NO)C1 |
| InChI | InChI=1S/C8H17N3O4S/c1-16(13,14)5-3-11-2-4-15-7(6-11)8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10) |
| InChIKey | NTMYERUPYIVYCQ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|