C14H24O2S — CID 79682881
3-(1-adamantylmethylsulfanyl)propane-1,2-diol (PubChem CID 79682881) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is 3-(1-adamantylmethylsulfanyl)propane-1,2-diol.
| Compound Name | 3-(1-adamantylmethylsulfanyl)propane-1,2-diol |
|---|---|
| PubChem CID | 79682881 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-(1-adamantylmethylsulfanyl)propane-1,2-diol |
| SMILES | OCC(O)CSCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H24O2S/c15-7-13(16)8-17-9-14-4-10-1-11(5-14)3-12(2-10)6-14/h10-13,15-16H,1-9H2 |
| InChIKey | QLKRBMKLEZFWIA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |