2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid

C5H9FO4S — CID 79683120

IUPAC2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid
SMILESO=C(O)C(F)SCC(O)CO
InChIInChI=1S/C5H9FO4S/c6-4(5(9)10)11-2-3(8)1-7/h3-4,7-8H,1-2H2,(H,9,10)
InChIKeyDOUNTUWKBLSFIR-UHFFFAOYSA-N
MW184.19 g/mol
LogP-0.55
Rot. Bonds5

About 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid

2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid (PubChem CID 79683120) has the molecular formula C5H9FO4S and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid.

Molecular Properties

Compound Name2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid
PubChem CID79683120
Molecular FormulaC5H9FO4S
Molecular Weight184.19 g/mol
Exact Mass184.02
IUPAC Name2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid
SMILESO=C(O)C(F)SCC(O)CO
InChIInChI=1S/C5H9FO4S/c6-4(5(9)10)11-2-3(8)1-7/h3-4,7-8H,1-2H2,(H,9,10)
InChIKeyDOUNTUWKBLSFIR-UHFFFAOYSA-N
XLogP-0.55
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 5-0.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid?
The IUPAC name of 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid (CID 79683120) is 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid.
What is the SMILES notation for 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid?
The canonical SMILES for 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid is O=C(O)C(F)SCC(O)CO.
What is the InChIKey of 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid?
The InChIKey is DOUNTUWKBLSFIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FO4S/c6-4(5(9)10)11-2-3(8)1-7/h3-4,7-8H,1-2H2,(H,9,10).
What are the key properties of 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid?
2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid has a molecular weight of 184.19 g/mol, XLogP of -0.55, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropylsulfanyl)-2-fluoroacetic acid is sourced from PubChem (CID 79683120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).