C11H14O6S2 — CID 87728882
2-(2,5-dihydroxyphenyl)sulfanyl-2-(2,3-dihydroxypropylsulfanyl)acetic acid (PubChem CID 87728882) has the molecular formula C11H14O6S2 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(2,5-dihydroxyphenyl)sulfanyl-2-(2,3-dihydroxypropylsulfanyl)acetic acid.
| Compound Name | 2-(2,5-dihydroxyphenyl)sulfanyl-2-(2,3-dihydroxypropylsulfanyl)acetic acid |
|---|---|
| PubChem CID | 87728882 |
| Molecular Formula | C11H14O6S2 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)sulfanyl-2-(2,3-dihydroxypropylsulfanyl)acetic acid |
| SMILES | O=C(O)C(SCC(O)CO)Sc1cc(O)ccc1O |
| InChI | InChI=1S/C11H14O6S2/c12-4-7(14)5-18-11(10(16)17)19-9-3-6(13)1-2-8(9)15/h1-3,7,11-15H,4-5H2,(H,16,17) |
| InChIKey | TZCVEPLWVNXPLS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|