C9H12O2S — CID 86025548
2-propan-2-ylsulfanylbenzene-1,4-diol (PubChem CID 86025548) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-propan-2-ylsulfanylbenzene-1,4-diol.
| Compound Name | 2-propan-2-ylsulfanylbenzene-1,4-diol |
|---|---|
| PubChem CID | 86025548 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-propan-2-ylsulfanylbenzene-1,4-diol |
| SMILES | CC(C)Sc1cc(O)ccc1O |
| InChI | InChI=1S/C9H12O2S/c1-6(2)12-9-5-7(10)3-4-8(9)11/h3-6,10-11H,1-2H3 |
| InChIKey | UIPDRSDBBQVZOI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|