C15H15IOS — CID 79686034
(5-iodothiophen-3-yl)-(2,3,5,6-tetramethylphenyl)methanone (PubChem CID 79686034) has the molecular formula C15H15IOS and a molecular weight of 370.26 g/mol. Its IUPAC name is (5-iodothiophen-3-yl)-(2,3,5,6-tetramethylphenyl)methanone.
| Compound Name | (5-iodothiophen-3-yl)-(2,3,5,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 79686034 |
| Molecular Formula | C15H15IOS |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | (5-iodothiophen-3-yl)-(2,3,5,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C)c(C(=O)c2csc(I)c2)c1C |
| InChI | InChI=1S/C15H15IOS/c1-8-5-9(2)11(4)14(10(8)3)15(17)12-6-13(16)18-7-12/h5-7H,1-4H3 |
| InChIKey | RIWJKJJTSIMHNI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|