C14H14N4O3 — CID 79721869
N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 79721869) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79721869 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-(5-amino-2,3-dihydro-1H-inden-1-yl)-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | Nc1ccc2c(c1)CCC2NC(=O)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C14H14N4O3/c15-9-2-3-10-8(7-9)1-4-11(10)17-14(19)12-5-6-13(16-12)18(20)21/h2-3,5-7,11,16H,1,4,15H2,(H,17,19) |
| InChIKey | OKCJASCOCZDPEB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|