C14H20N2O — CID 79724299
1-N-(3-ethenoxypropyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79724299) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-N-(3-ethenoxypropyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(3-ethenoxypropyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79724299 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-N-(3-ethenoxypropyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | C=COCCCNC1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H20N2O/c1-2-17-9-3-8-16-14-7-4-11-10-12(15)5-6-13(11)14/h2,5-6,10,14,16H,1,3-4,7-9,15H2 |
| InChIKey | UBZMSSQBHGXYAZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|