C15H18N2S — CID 79741216
1-N-(2-thiophen-3-ylethyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79741216) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 1-N-(2-thiophen-3-ylethyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(2-thiophen-3-ylethyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79741216 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-N-(2-thiophen-3-ylethyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2NCCc1ccsc1 |
| InChI | InChI=1S/C15H18N2S/c16-13-2-3-14-12(9-13)1-4-15(14)17-7-5-11-6-8-18-10-11/h2-3,6,8-10,15,17H,1,4-5,7,16H2 |
| InChIKey | KYINMAAVLHUMLB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|