C16H16F2N2 — CID 79741947
1-N-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79741947) has the molecular formula C16H16F2N2 and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-N-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79741947 |
| Molecular Formula | C16H16F2N2 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1-N-[(3,4-difluorophenyl)methyl]-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | Nc1ccc2c(c1)CCC2NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N2/c17-14-5-1-10(7-15(14)18)9-20-16-6-2-11-8-12(19)3-4-13(11)16/h1,3-5,7-8,16,20H,2,6,9,19H2 |
| InChIKey | UYCQZCBSSPYPRO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|