C17H20N2O — CID 79735926
1-N-(4-ethoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 79735926) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-N-(4-ethoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine.
| Compound Name | 1-N-(4-ethoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine |
|---|---|
| PubChem CID | 79735926 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-N-(4-ethoxyphenyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CCOc1ccc(NC2CCc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-2-20-15-7-5-14(6-8-15)19-17-10-3-12-11-13(18)4-9-16(12)17/h4-9,11,17,19H,2-3,10,18H2,1H3 |
| InChIKey | COYNAXXVPIUWIO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|