C17H26N2OS — CID 79737349
3-[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidin-4-yl]oxypropan-1-amine (PubChem CID 79737349) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is 3-[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidin-4-yl]oxypropan-1-amine.
| Compound Name | 3-[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidin-4-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 79737349 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-[1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidin-4-yl]oxypropan-1-amine |
| SMILES | NCCCOC1CCN(CC2Cc3ccccc3S2)CC1 |
| InChI | InChI=1S/C17H26N2OS/c18-8-3-11-20-15-6-9-19(10-7-15)13-16-12-14-4-1-2-5-17(14)21-16/h1-2,4-5,15-16H,3,6-13,18H2 |
| InChIKey | RWEVBWRJSHXRPH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|