C13H16BrN — CID 79748412
7-(2-bromocyclopentyl)-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 79748412) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is 7-(2-bromocyclopentyl)-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 7-(2-bromocyclopentyl)-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 79748412 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 7-(2-bromocyclopentyl)-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | BrC1CCCC1C1CCc2cccnc21 |
| InChI | InChI=1S/C13H16BrN/c14-12-5-1-4-10(12)11-7-6-9-3-2-8-15-13(9)11/h2-3,8,10-12H,1,4-7H2 |
| InChIKey | LWHQAOXTGVXTME-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|