About 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one
4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one (PubChem CID 164650840) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one.
Molecular Properties
| Compound Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one |
| PubChem CID | 164650840 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one |
| SMILES | O=C1COCC1C1CCc2cccnc21 |
| InChI | InChI=1S/C12H13NO2/c14-11-7-15-6-10(11)9-4-3-8-2-1-5-13-12(8)9/h1-2,5,9-10H,3-4,6-7H2 |
| InChIKey | ZFURCVCDOBFCTM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one?
The IUPAC name of 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one (CID 164650840) is 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one.
What is the SMILES notation for 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one?
The canonical SMILES for 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one is O=C1COCC1C1CCc2cccnc21.
What is the InChIKey of 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one?
The InChIKey is ZFURCVCDOBFCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c14-11-7-15-6-10(11)9-4-3-8-2-1-5-13-12(8)9/h1-2,5,9-10H,3-4,6-7H2.
What are the key properties of 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one?
4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one has a molecular weight of 203.24 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)oxolan-3-one is sourced from PubChem (CID 164650840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).