C16H27IN2O2 — CID 79781251
5-iodo-3-nonyl-1-propylpyrimidine-2,4-dione (PubChem CID 79781251) has the molecular formula C16H27IN2O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 5-iodo-3-nonyl-1-propylpyrimidine-2,4-dione.
| Compound Name | 5-iodo-3-nonyl-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79781251 |
| Molecular Formula | C16H27IN2O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-iodo-3-nonyl-1-propylpyrimidine-2,4-dione |
| SMILES | CCCCCCCCCn1c(=O)c(I)cn(CCC)c1=O |
| InChI | InChI=1S/C16H27IN2O2/c1-3-5-6-7-8-9-10-12-19-15(20)14(17)13-18(11-4-2)16(19)21/h13H,3-12H2,1-2H3 |
| InChIKey | SJUYKYRWZBQWPB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|