C9H11N5O — CID 79783648
6-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]pyridin-3-ol (PubChem CID 79783648) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 6-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]pyridin-3-ol.
| Compound Name | 6-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79783648 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 6-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]pyridin-3-ol |
| SMILES | Oc1ccc(CNCc2ncn[nH]2)nc1 |
| InChI | InChI=1S/C9H11N5O/c15-8-2-1-7(11-4-8)3-10-5-9-12-6-13-14-9/h1-2,4,6,10,15H,3,5H2,(H,12,13,14) |
| InChIKey | RFAXDGMQBKBIPO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |