C10H9Cl3N4 — CID 93396129
N-(1H-1,2,4-triazol-5-ylmethyl)-1-(2,3,6-trichlorophenyl)methanamine (PubChem CID 93396129) has the molecular formula C10H9Cl3N4 and a molecular weight of 291.57 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)-1-(2,3,6-trichlorophenyl)methanamine.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)-1-(2,3,6-trichlorophenyl)methanamine |
|---|---|
| PubChem CID | 93396129 |
| Molecular Formula | C10H9Cl3N4 |
| Molecular Weight | 291.57 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)-1-(2,3,6-trichlorophenyl)methanamine |
| SMILES | Clc1ccc(Cl)c(CNCc2ncn[nH]2)c1Cl |
| InChI | InChI=1S/C10H9Cl3N4/c11-7-1-2-8(12)10(13)6(7)3-14-4-9-15-5-16-17-9/h1-2,5,14H,3-4H2,(H,15,16,17) |
| InChIKey | QWFXZSLZRLMEFG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|