About 3-iodo-1-octylpyrazole
3-iodo-1-octylpyrazole (PubChem CID 79787122) has the molecular formula C11H19IN2
and a molecular weight of 306.19 g/mol. Its IUPAC name is 3-iodo-1-octylpyrazole.
Molecular Properties
| Compound Name | 3-iodo-1-octylpyrazole |
| PubChem CID | 79787122 |
| Molecular Formula | C11H19IN2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-iodo-1-octylpyrazole |
| SMILES | CCCCCCCCn1ccc(I)n1 |
| InChI | InChI=1S/C11H19IN2/c1-2-3-4-5-6-7-9-14-10-8-11(12)13-14/h8,10H,2-7,9H2,1H3 |
| InChIKey | SZVORNRJJUBFIU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1-octylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1-octylpyrazole?
The IUPAC name of 3-iodo-1-octylpyrazole (CID 79787122) is 3-iodo-1-octylpyrazole.
What is the SMILES notation for 3-iodo-1-octylpyrazole?
The canonical SMILES for 3-iodo-1-octylpyrazole is CCCCCCCCn1ccc(I)n1.
What is the InChIKey of 3-iodo-1-octylpyrazole?
The InChIKey is SZVORNRJJUBFIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19IN2/c1-2-3-4-5-6-7-9-14-10-8-11(12)13-14/h8,10H,2-7,9H2,1H3.
What are the key properties of 3-iodo-1-octylpyrazole?
3-iodo-1-octylpyrazole has a molecular weight of 306.19 g/mol, XLogP of 3.85, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1-octylpyrazole is sourced from PubChem (CID 79787122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).